C17H21N3O7S — CID 86681742
2-[5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]-2,3-dioxoindol-1-yl]acetic acid (PubChem CID 86681742) has the molecular formula C17H21N3O7S and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-[5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]-2,3-dioxoindol-1-yl]acetic acid.
| Compound Name | 2-[5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]-2,3-dioxoindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 86681742 |
| Molecular Formula | C17H21N3O7S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]-2,3-dioxoindol-1-yl]acetic acid |
| SMILES | CS(=O)(=O)N(CCN1CCOCC1)c1ccc2c(c1)C(=O)C(=O)N2CC(=O)O |
| InChI | InChI=1S/C17H21N3O7S/c1-28(25,26)20(5-4-18-6-8-27-9-7-18)12-2-3-14-13(10-12)16(23)17(24)19(14)11-15(21)22/h2-3,10H,4-9,11H2,1H3,(H,21,22) |
| InChIKey | FCVWMEUHGZCLPF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|