C16H22N2O7S — CID 86720510
3-acetyloxy-5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoic acid (PubChem CID 86720510) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-acetyloxy-5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoic acid.
| Compound Name | 3-acetyloxy-5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 86720510 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-acetyloxy-5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoic acid |
| SMILES | CC(=O)Oc1cc(C(=O)O)cc(N(CCN2CCOCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H22N2O7S/c1-12(19)25-15-10-13(16(20)21)9-14(11-15)18(26(2,22)23)4-3-17-5-7-24-8-6-17/h9-11H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | RPAPJTAUMMPQTE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|