C18H27N3O5S — CID 6494041
2-(3-acetyl-N-methylsulfonylanilino)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 6494041) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 6494041 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)NCCCN2CCOCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H27N3O5S/c1-15(22)16-5-3-6-17(13-16)21(27(2,24)25)14-18(23)19-7-4-8-20-9-11-26-12-10-20/h3,5-6,13H,4,7-12,14H2,1-2H3,(H,19,23) |
| InChIKey | OSZRKNYUGGPIOF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|