C15H22N2O4S — CID 3917136
2-(3-acetyl-N-methylsulfonylanilino)-N-(2-methylpropyl)acetamide (PubChem CID 3917136) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(3-acetyl-N-methylsulfonylanilino)-N-(2-methylpropyl)acetamide.
| Compound Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 3917136 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(2-methylpropyl)acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)NCC(C)C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H22N2O4S/c1-11(2)9-16-15(19)10-17(22(4,20)21)14-7-5-6-13(8-14)12(3)18/h5-8,11H,9-10H2,1-4H3,(H,16,19) |
| InChIKey | DWUJOZRZFUFXSP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |