C22H28N2O4S — CID 132947517
2-(3-acetyl-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide (PubChem CID 132947517) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide.
| Compound Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 132947517 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-(3-acetyl-N-methylsulfonylanilino)-N-(3-methyl-1-phenylbutyl)acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)NC(CC(C)C)c2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H28N2O4S/c1-16(2)13-21(18-9-6-5-7-10-18)23-22(26)15-24(29(4,27)28)20-12-8-11-19(14-20)17(3)25/h5-12,14,16,21H,13,15H2,1-4H3,(H,23,26) |
| InChIKey | DKYJNEVBPJQQQT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |