C16H26N2O5S2 — CID 86703853
tert-butyl 5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]thiophene-2-carboxylate (PubChem CID 86703853) has the molecular formula C16H26N2O5S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is tert-butyl 5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]thiophene-2-carboxylate.
| Compound Name | tert-butyl 5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86703853 |
| Molecular Formula | C16H26N2O5S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | tert-butyl 5-[methylsulfonyl(2-morpholin-4-ylethyl)amino]thiophene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N(CCN2CCOCC2)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H26N2O5S2/c1-16(2,3)23-15(19)13-5-6-14(24-13)18(25(4,20)21)8-7-17-9-11-22-12-10-17/h5-6H,7-12H2,1-4H3 |
| InChIKey | SUMZRQFVNAXFDH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |