C15H18N2O4 — CID 86681753
tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate (PubChem CID 86681753) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate.
| Compound Name | tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 86681753 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)c2ccc(CN)cc2C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-12(18)8-17-13(19)10-5-4-9(7-16)6-11(10)14(17)20/h4-6H,7-8,16H2,1-3H3 |
| InChIKey | ASPLPBKMULRJGE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|