About tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate
tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate (PubChem CID 86681753) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate |
| PubChem CID | 86681753 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)c2ccc(CN)cc2C1=O |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-12(18)8-17-13(19)10-5-4-9(7-16)6-11(10)14(17)20/h4-6H,7-8,16H2,1-3H3 |
| InChIKey | ASPLPBKMULRJGE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate?
The IUPAC name of tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate (CID 86681753) is tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate.
What is the SMILES notation for tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate?
The canonical SMILES for tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate is CC(C)(C)OC(=O)CN1C(=O)c2ccc(CN)cc2C1=O.
What is the InChIKey of tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate?
The InChIKey is ASPLPBKMULRJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-15(2,3)21-12(18)8-17-13(19)10-5-4-9(7-16)6-11(10)14(17)20/h4-6H,7-8,16H2,1-3H3.
What are the key properties of tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate?
tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate has a molecular weight of 290.32 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[5-(aminomethyl)-1,3-dioxoisoindol-2-yl]acetate is sourced from PubChem (CID 86681753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).