C23H25NO5 — CID 69213221
tert-butyl 3-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]propanoate (PubChem CID 69213221) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]propanoate.
| Compound Name | tert-butyl 3-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 69213221 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | tert-butyl 3-[3-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOc1cccc(CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H25NO5/c1-23(2,3)29-20(25)12-14-28-17-8-6-7-16(15-17)11-13-24-21(26)18-9-4-5-10-19(18)22(24)27/h4-10,15H,11-14H2,1-3H3 |
| InChIKey | LDVGLRJFENATRV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|