C17H22N2O4 — CID 134509436
tert-butyl 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]acetate (PubChem CID 134509436) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]acetate |
|---|---|
| PubChem CID | 134509436 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl 2-[2-(1,3-dioxoisoindol-2-yl)ethyl-methylamino]acetate |
| SMILES | CN(CCN1C(=O)c2ccccc2C1=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,3)23-14(20)11-18(4)9-10-19-15(21)12-7-5-6-8-13(12)16(19)22/h5-8H,9-11H2,1-4H3 |
| InChIKey | ZOONNJZUUDQBBF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|