C33H35N3O6 — CID 101025400
tert-butyl 2-[4-(1,3-dioxoisoindol-2-yl)butyl-(9H-fluoren-9-ylmethoxycarbonylamino)amino]acetate (PubChem CID 101025400) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is tert-butyl 2-[4-(1,3-dioxoisoindol-2-yl)butyl-(9H-fluoren-9-ylmethoxycarbonylamino)amino]acetate.
| Compound Name | tert-butyl 2-[4-(1,3-dioxoisoindol-2-yl)butyl-(9H-fluoren-9-ylmethoxycarbonylamino)amino]acetate |
|---|---|
| PubChem CID | 101025400 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | tert-butyl 2-[4-(1,3-dioxoisoindol-2-yl)butyl-(9H-fluoren-9-ylmethoxycarbonylamino)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CCCCN1C(=O)c2ccccc2C1=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H35N3O6/c1-33(2,3)42-29(37)20-35(18-10-11-19-36-30(38)26-16-8-9-17-27(26)31(36)39)34-32(40)41-21-28-24-14-6-4-12-22(24)23-13-5-7-15-25(23)28/h4-9,12-17,28H,10-11,18-21H2,1-3H3,(H,34,40) |
| InChIKey | GDAOCVROKXDLBI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|