C37H46N2O5 — CID 18616265
tert-butyl 3-[3-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]propanoate (PubChem CID 18616265) has the molecular formula C37H46N2O5 and a molecular weight of 598.78 g/mol. Its IUPAC name is tert-butyl 3-[3-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 18616265 |
| Molecular Formula | C37H46N2O5 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | tert-butyl 3-[3-[2-[2-[4-(dimethylamino)butoxy]phenyl]ethyl]-5-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]propanoate |
| SMILES | CN(C)CCCCOc1ccccc1CCc1cc(CCC(=O)OC(C)(C)C)cc(CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C37H46N2O5/c1-37(2,3)44-34(40)19-17-28-24-27(16-18-30-12-6-9-15-33(30)43-23-11-10-21-38(4)5)25-29(26-28)20-22-39-35(41)31-13-7-8-14-32(31)36(39)42/h6-9,12-15,24-26H,10-11,16-23H2,1-5H3 |
| InChIKey | FBFVDYPSTSKWMC-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|