C24H28N4O4 — CID 10574942
methyl (2Z)-5-(dimethylamino)-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]hydrazinylidene]pentanoate (PubChem CID 10574942) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl (2Z)-5-(dimethylamino)-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]hydrazinylidene]pentanoate.
| Compound Name | methyl (2Z)-5-(dimethylamino)-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]hydrazinylidene]pentanoate |
|---|---|
| PubChem CID | 10574942 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl (2Z)-5-(dimethylamino)-2-[[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl]hydrazinylidene]pentanoate |
| SMILES | COC(=O)/C(CCCN(C)C)=N\Nc1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-27(2)15-6-9-21(24(31)32-3)26-25-18-12-10-17(11-13-18)14-16-28-22(29)19-7-4-5-8-20(19)23(28)30/h4-5,7-8,10-13,25H,6,9,14-16H2,1-3H3/b26-21- |
| InChIKey | XSIXPVCPALXQBN-QLYXXIJNSA-N |
| XLogP | 2.81 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|