C21H20ClN3O4 — CID 11327438
ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-5-(1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 11327438) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-5-(1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 11327438 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | ethyl (2Z)-2-[(4-chlorophenyl)hydrazinylidene]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CCOC(=O)/C(CCCN1C(=O)c2ccccc2C1=O)=N\Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-2-29-21(28)18(24-23-15-11-9-14(22)10-12-15)8-5-13-25-19(26)16-6-3-4-7-17(16)20(25)27/h3-4,6-7,9-12,23H,2,5,8,13H2,1H3/b24-18- |
| InChIKey | AQQGCCOUEFYQJK-MOHJPFBDSA-N |
| XLogP | 3.75 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|