C24H28N2O4 — CID 175174475
ethyl 7-(1,3-dioxoisoindol-2-yl)-2-(4-methylanilino)heptanoate (PubChem CID 175174475) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl 7-(1,3-dioxoisoindol-2-yl)-2-(4-methylanilino)heptanoate.
| Compound Name | ethyl 7-(1,3-dioxoisoindol-2-yl)-2-(4-methylanilino)heptanoate |
|---|---|
| PubChem CID | 175174475 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | ethyl 7-(1,3-dioxoisoindol-2-yl)-2-(4-methylanilino)heptanoate |
| SMILES | CCOC(=O)C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-3-30-24(29)21(25-18-14-12-17(2)13-15-18)11-5-4-8-16-26-22(27)19-9-6-7-10-20(19)23(26)28/h6-7,9-10,12-15,21,25H,3-5,8,11,16H2,1-2H3 |
| InChIKey | PNTNZEGRKGQSGJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|