C23H26N2O3 — CID 164676175
(2R)-8-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenyloctanamide (PubChem CID 164676175) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2R)-8-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenyloctanamide.
| Compound Name | (2R)-8-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenyloctanamide |
|---|---|
| PubChem CID | 164676175 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2R)-8-(1,3-dioxoisoindol-2-yl)-2-methyl-N-phenyloctanamide |
| SMILES | C[C@H](CCCCCCN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c1-17(21(26)24-18-12-6-4-7-13-18)11-5-2-3-10-16-25-22(27)19-14-8-9-15-20(19)23(25)28/h4,6-9,12-15,17H,2-3,5,10-11,16H2,1H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | SMQZXLYWHICXOT-QGZVFWFLSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|