C31H37N3O8 — CID 70045092
2-[3-[[(2S)-10-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid (PubChem CID 70045092) has the molecular formula C31H37N3O8 and a molecular weight of 579.65 g/mol. Its IUPAC name is 2-[3-[[(2S)-10-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid.
| Compound Name | 2-[3-[[(2S)-10-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 70045092 |
| Molecular Formula | C31H37N3O8 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 2-[3-[[(2S)-10-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
| SMILES | CCOC(=O)[C@H](CCCCCCCCN1C(=O)c2ccccc2C1=O)NC1COc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C31H37N3O8/c1-2-41-31(40)23(32-24-20-42-26-17-11-10-16-25(26)34(30(24)39)19-27(35)36)15-7-5-3-4-6-12-18-33-28(37)21-13-8-9-14-22(21)29(33)38/h8-11,13-14,16-17,23-24,32H,2-7,12,15,18-20H2,1H3,(H,35,36)/t23-,24?/m0/s1 |
| InChIKey | IFXSMORUKURHMK-UXMRNZNESA-N |
| XLogP | 3.41 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|