C24H35N3O6 — CID 54188688
2-[(3S)-3-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid (PubChem CID 54188688) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[(3S)-3-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid.
| Compound Name | 2-[(3S)-3-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 54188688 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2-[(3S)-3-[(1-ethoxy-1-oxo-6-piperidin-4-ylhexan-2-yl)amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
| SMILES | CCOC(=O)C(CCCCC1CCNCC1)N[C@H]1COc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C24H35N3O6/c1-2-32-24(31)18(8-4-3-7-17-11-13-25-14-12-17)26-19-16-33-21-10-6-5-9-20(21)27(23(19)30)15-22(28)29/h5-6,9-10,17-19,25-26H,2-4,7-8,11-16H2,1H3,(H,28,29)/t18?,19-/m0/s1 |
| InChIKey | PGYRJADZMZZNCQ-GGYWPGCISA-N |
| XLogP | 1.95 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|