C23H35N3O6 — CID 70425933
2-[3-[[(2S)-10-amino-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid (PubChem CID 70425933) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-[3-[[(2S)-10-amino-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid.
| Compound Name | 2-[3-[[(2S)-10-amino-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
|---|---|
| PubChem CID | 70425933 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 2-[3-[[(2S)-10-amino-1-ethoxy-1-oxodecan-2-yl]amino]-4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl]acetic acid |
| SMILES | CCOC(=O)[C@H](CCCCCCCCN)NC1COc2ccccc2N(CC(=O)O)C1=O |
| InChI | InChI=1S/C23H35N3O6/c1-2-31-23(30)17(11-7-5-3-4-6-10-14-24)25-18-16-32-20-13-9-8-12-19(20)26(22(18)29)15-21(27)28/h8-9,12-13,17-18,25H,2-7,10-11,14-16,24H2,1H3,(H,27,28)/t17-,18?/m0/s1 |
| InChIKey | SGPDLMPEWCCVQJ-ZENAZSQFSA-N |
| XLogP | 2.08 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|