C19H27N3O6 — CID 70044349
(2S)-8-amino-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]octanoic acid (PubChem CID 70044349) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2S)-8-amino-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]octanoic acid.
| Compound Name | (2S)-8-amino-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]octanoic acid |
|---|---|
| PubChem CID | 70044349 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S)-8-amino-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]octanoic acid |
| SMILES | NCCCCCC[C@H](NC1COc2ccccc2N(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C19H27N3O6/c20-10-6-2-1-3-7-13(19(26)27)21-14-12-28-16-9-5-4-8-15(16)22(18(14)25)11-17(23)24/h4-5,8-9,13-14,21H,1-3,6-7,10-12,20H2,(H,23,24)(H,26,27)/t13-,14?/m0/s1 |
| InChIKey | JXJBMQWOJKYRJC-LSLKUGRBSA-N |
| XLogP | 0.82 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|