C34H35N3O8 — CID 70044576
ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2-[[4-oxo-5-(2-oxo-2-phenylmethoxyethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]hexanoate (PubChem CID 70044576) has the molecular formula C34H35N3O8 and a molecular weight of 613.67 g/mol. Its IUPAC name is ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2-[[4-oxo-5-(2-oxo-2-phenylmethoxyethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]hexanoate.
| Compound Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2-[[4-oxo-5-(2-oxo-2-phenylmethoxyethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]hexanoate |
|---|---|
| PubChem CID | 70044576 |
| Molecular Formula | C34H35N3O8 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | ethyl (2S)-6-(1,3-dioxoisoindol-2-yl)-2-[[4-oxo-5-(2-oxo-2-phenylmethoxyethyl)-2,3-dihydro-1,5-benzoxazepin-3-yl]amino]hexanoate |
| SMILES | CCOC(=O)[C@H](CCCCN1C(=O)c2ccccc2C1=O)NC1COc2ccccc2N(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C34H35N3O8/c1-2-43-34(42)26(16-10-11-19-36-31(39)24-14-6-7-15-25(24)32(36)40)35-27-22-44-29-18-9-8-17-28(29)37(33(27)41)20-30(38)45-21-23-12-4-3-5-13-23/h3-9,12-15,17-18,26-27,35H,2,10-11,16,19-22H2,1H3/t26-,27?/m0/s1 |
| InChIKey | XHHVORRVNJJRDZ-QBHOUYDASA-N |
| XLogP | 3.51 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|