C20H19NO5 — CID 7524606
(1,3-dioxoisoindol-2-yl)methyl 3-(2-ethoxyphenyl)propanoate (PubChem CID 7524606) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-(2-ethoxyphenyl)propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-(2-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7524606 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-(2-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccccc1CCC(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H19NO5/c1-2-25-17-10-6-3-7-14(17)11-12-18(22)26-13-21-19(23)15-8-4-5-9-16(15)20(21)24/h3-10H,2,11-13H2,1H3 |
| InChIKey | RUGJWPLIGKVTBG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|