C20H20N2O7S — CID 2570645
(1,3-dioxoisoindol-2-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 2570645) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2570645 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O7S/c1-2-28-14-7-9-15(10-8-14)30(26,27)21-12-11-18(23)29-13-22-19(24)16-5-3-4-6-17(16)20(22)25/h3-10,21H,2,11-13H2,1H3 |
| InChIKey | JCAUBIRELTXCQD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|