C20H21NO5S2 — CID 55884702
1-benzothiophen-3-ylmethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 55884702) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-benzothiophen-3-ylmethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | 1-benzothiophen-3-ylmethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55884702 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 1-benzothiophen-3-ylmethyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCc2csc3ccccc23)cc1 |
| InChI | InChI=1S/C20H21NO5S2/c1-2-25-16-7-9-17(10-8-16)28(23,24)21-12-11-20(22)26-13-15-14-27-19-6-4-3-5-18(15)19/h3-10,14,21H,2,11-13H2,1H3 |
| InChIKey | ZPFWWMPHVGEDKI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |