C21H21FN2O5S — CID 55649316
(5-fluoroquinolin-8-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 55649316) has the molecular formula C21H21FN2O5S and a molecular weight of 432.47 g/mol. Its IUPAC name is (5-fluoroquinolin-8-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (5-fluoroquinolin-8-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55649316 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (5-fluoroquinolin-8-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCc2ccc(F)c3cccnc23)cc1 |
| InChI | InChI=1S/C21H21FN2O5S/c1-2-28-16-6-8-17(9-7-16)30(26,27)24-13-11-20(25)29-14-15-5-10-19(22)18-4-3-12-23-21(15)18/h3-10,12,24H,2,11,13-14H2,1H3 |
| InChIKey | XSDSNJJJQWOBLP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |