C16H23N5O5S — CID 18204568
(1-propyltetrazol-5-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 18204568) has the molecular formula C16H23N5O5S and a molecular weight of 397.46 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 18204568 |
| Molecular Formula | C16H23N5O5S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCCn1nnnc1COC(=O)CCNS(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C16H23N5O5S/c1-3-11-21-15(18-19-20-21)12-26-16(22)9-10-17-27(23,24)14-7-5-13(6-8-14)25-4-2/h5-8,17H,3-4,9-12H2,1-2H3 |
| InChIKey | CVUPRRADVJDHCR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |