C17H22N2O7S — CID 5199971
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 5199971) has the molecular formula C17H22N2O7S and a molecular weight of 398.44 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 5199971 |
| Molecular Formula | C17H22N2O7S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCC(=O)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O7S/c1-2-25-13-5-7-14(8-6-13)27(23,24)18-10-9-17(22)26-12-16(21)19-11-3-4-15(19)20/h5-8,18H,2-4,9-12H2,1H3 |
| InChIKey | UZTRIARVJRBZGM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |