C19H27N3O7S — CID 3948557
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 3948557) has the molecular formula C19H27N3O7S and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3948557 |
| Molecular Formula | C19H27N3O7S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCC(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H27N3O7S/c1-2-28-15-7-9-16(10-8-15)30(26,27)20-12-11-18(24)29-13-17(23)22-19(25)21-14-5-3-4-6-14/h7-10,14,20H,2-6,11-13H2,1H3,(H2,21,22,23,25) |
| InChIKey | LOLLRDALAMEPNK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |