C18H24N2O5 — CID 7840574
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate (PubChem CID 7840574) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7840574 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(4-methylphenoxy)propanoate |
| SMILES | Cc1ccc(OCCC(=O)OCC(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O5/c1-13-6-8-15(9-7-13)24-11-10-17(22)25-12-16(21)20-18(23)19-14-4-2-3-5-14/h6-9,14H,2-5,10-12H2,1H3,(H2,19,20,21,23) |
| InChIKey | IJNSSHZWLSEKTI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |