C17H24N2O7S — CID 4043815
(2-morpholin-4-yl-2-oxoethyl) 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 4043815) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 4043815 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H24N2O7S/c1-2-25-14-3-5-15(6-4-14)27(22,23)18-8-7-17(21)26-13-16(20)19-9-11-24-12-10-19/h3-6,18H,2,7-13H2,1H3 |
| InChIKey | QUTFFDUNTQRLPH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |