C16H20FN3O6S — CID 7954163
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]acetate (PubChem CID 7954163) has the molecular formula C16H20FN3O6S and a molecular weight of 401.42 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7954163 |
| Molecular Formula | C16H20FN3O6S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1ccc(F)cc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20FN3O6S/c17-11-5-7-13(8-6-11)27(24,25)18-9-15(22)26-10-14(21)20-16(23)19-12-3-1-2-4-12/h5-8,12,18H,1-4,9-10H2,(H2,19,20,21,23) |
| InChIKey | VFYLNSLIYHCARK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |