C15H19FN2O6S — CID 7883785
[2-(cyclopentylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 7883785) has the molecular formula C15H19FN2O6S and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 7883785 |
| Molecular Formula | C15H19FN2O6S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | O=C(COC(=O)CONS(=O)(=O)c1ccc(F)cc1)NC1CCCC1 |
| InChI | InChI=1S/C15H19FN2O6S/c16-11-5-7-13(8-6-11)25(21,22)18-24-10-15(20)23-9-14(19)17-12-3-1-2-4-12/h5-8,12,18H,1-4,9-10H2,(H,17,19) |
| InChIKey | IVQAYFTZWDUTPK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|