C18H25FN2O6S — CID 11918196
[2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 11918196) has the molecular formula C18H25FN2O6S and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 11918196 |
| Molecular Formula | C18H25FN2O6S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-[[(1R,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)COC(=O)CONS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN2O6S/c1-12-4-3-5-16(13(12)2)20-17(22)10-26-18(23)11-27-21-28(24,25)15-8-6-14(19)7-9-15/h6-9,12-13,16,21H,3-5,10-11H2,1-2H3,(H,20,22)/t12-,13-,16-/m1/s1 |
| InChIKey | BZBDPXNBTSNIMV-XJKCOSOUSA-N |
| XLogP | 1.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|