C15H15FN2O7S — CID 7883762
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 7883762) has the molecular formula C15H15FN2O7S and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 7883762 |
| Molecular Formula | C15H15FN2O7S |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | O=C(COC(=O)CONS(=O)(=O)c1ccc(F)cc1)NCc1ccco1 |
| InChI | InChI=1S/C15H15FN2O7S/c16-11-3-5-13(6-4-11)26(21,22)18-25-10-15(20)24-9-14(19)17-8-12-2-1-7-23-12/h1-7,18H,8-10H2,(H,17,19) |
| InChIKey | NCZJABFDRZBSIF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|