About 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate
2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 29169744) has the molecular formula C20H18FNO6S
and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| PubChem CID | 29169744 |
| Molecular Formula | C20H18FNO6S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCCOc1ccc(F)cc1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H18FNO6S/c21-16-5-7-17(8-6-16)27-12-13-28-20(23)15-3-9-19(10-4-15)29(24,25)22-14-18-2-1-11-26-18/h1-11,22H,12-14H2 |
| InChIKey | HQASALHJZUUMAC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate?
The IUPAC name of 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate (CID 29169744) is 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate.
What is the SMILES notation for 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate?
The canonical SMILES for 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate is O=C(OCCOc1ccc(F)cc1)c1ccc(S(=O)(=O)NCc2ccco2)cc1.
What is the InChIKey of 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate?
The InChIKey is HQASALHJZUUMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FNO6S/c21-16-5-7-17(8-6-16)27-12-13-28-20(23)15-3-9-19(10-4-15)29(24,25)22-14-18-2-1-11-26-18/h1-11,22H,12-14H2.
What are the key properties of 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate?
2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate has a molecular weight of 419.43 g/mol, XLogP of 3.13, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenoxy)ethyl 4-(furan-2-ylmethylsulfamoyl)benzoate is sourced from PubChem (CID 29169744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).