C24H21F2N3O7S2 — CID 25040685
[2-(cyclopropylamino)-2-oxoethyl] 3,5-bis[(4-fluorophenyl)sulfonylamino]benzoate (PubChem CID 25040685) has the molecular formula C24H21F2N3O7S2 and a molecular weight of 565.58 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 3,5-bis[(4-fluorophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 3,5-bis[(4-fluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25040685 |
| Molecular Formula | C24H21F2N3O7S2 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 3,5-bis[(4-fluorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1cc(NS(=O)(=O)c2ccc(F)cc2)cc(NS(=O)(=O)c2ccc(F)cc2)c1)NC1CC1 |
| InChI | InChI=1S/C24H21F2N3O7S2/c25-16-1-7-21(8-2-16)37(32,33)28-19-11-15(24(31)36-14-23(30)27-18-5-6-18)12-20(13-19)29-38(34,35)22-9-3-17(26)4-10-22/h1-4,7-13,18,28-29H,5-6,14H2,(H,27,30) |
| InChIKey | UDCRKUFVXHSCGB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |