C8H7FNO5S- — CID 2529382
2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 2529382) has the molecular formula C8H7FNO5S- and a molecular weight of 248.21 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 2529382 |
| Molecular Formula | C8H7FNO5S- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | O=C([O-])CONS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H8FNO5S/c9-6-1-3-7(4-2-6)16(13,14)10-15-5-8(11)12/h1-4,10H,5H2,(H,11,12)/p-1 |
| InChIKey | JYCJJJKCRVCGKY-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|