C18H19FN2O6S — CID 7883744
[(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 7883744) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 7883744 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | C[C@@H](OC(=O)CONS(=O)(=O)c1ccc(F)cc1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H19FN2O6S/c1-13(18(23)21(2)15-6-4-3-5-7-15)27-17(22)12-26-20-28(24,25)16-10-8-14(19)9-11-16/h3-11,13,20H,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | JOAGKJZYWMBCMG-CYBMUJFWSA-N |
| XLogP | 1.63 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|