C18H17BrFNO4 — CID 8525751
[(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate (PubChem CID 8525751) has the molecular formula C18H17BrFNO4 and a molecular weight of 410.24 g/mol. Its IUPAC name is [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate.
| Compound Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8525751 |
| Molecular Formula | C18H17BrFNO4 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | [(2S)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(F)cc1Br)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H17BrFNO4/c1-12(18(23)21(2)14-6-4-3-5-7-14)25-17(22)11-24-16-9-8-13(20)10-15(16)19/h3-10,12H,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | PVRWAJNMYHJLDZ-LBPRGKRZSA-N |
| XLogP | 3.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |