C11H11BrFNO4 — CID 8525758
[(2S)-1-amino-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate (PubChem CID 8525758) has the molecular formula C11H11BrFNO4 and a molecular weight of 320.11 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8525758 |
| Molecular Formula | C11H11BrFNO4 |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-(2-bromo-4-fluorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(F)cc1Br)C(N)=O |
| InChI | InChI=1S/C11H11BrFNO4/c1-6(11(14)16)18-10(15)5-17-9-3-2-7(13)4-8(9)12/h2-4,6H,5H2,1H3,(H2,14,16)/t6-/m0/s1 |
| InChIKey | ZEZNOZAFWMPSOB-LURJTMIESA-N |
| XLogP | 1.38 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |