C20H19F3N2O4 — CID 7880467
[(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 7880467) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7880467 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(2R)-1-(N-methylanilino)-1-oxopropan-2-yl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-13(19(28)25(2)16-6-4-3-5-7-16)29-17(26)12-24-18(27)14-8-10-15(11-9-14)20(21,22)23/h3-11,13H,12H2,1-2H3,(H,24,27)/t13-/m1/s1 |
| InChIKey | KOBVMZRTOKXXCI-CYBMUJFWSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |