C17H17FN2O7S — CID 7883765
[2-(4-methoxyanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate (PubChem CID 7883765) has the molecular formula C17H17FN2O7S and a molecular weight of 412.40 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
|---|---|
| PubChem CID | 7883765 |
| Molecular Formula | C17H17FN2O7S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-[(4-fluorophenyl)sulfonylamino]oxyacetate |
| SMILES | COc1ccc(NC(=O)COC(=O)CONS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FN2O7S/c1-25-14-6-4-13(5-7-14)19-16(21)10-26-17(22)11-27-20-28(23,24)15-8-2-12(18)3-9-15/h2-9,20H,10-11H2,1H3,(H,19,21) |
| InChIKey | IICAYZMNEIBWPW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|