C19H21NO8 — CID 138566980
4-O-[(1,3-dioxoisoindol-2-yl)methyl] 1-O-[2-(2-methylpropanoyloxy)ethyl] butanedioate (PubChem CID 138566980) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is 4-O-[(1,3-dioxoisoindol-2-yl)methyl] 1-O-[2-(2-methylpropanoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-[(1,3-dioxoisoindol-2-yl)methyl] 1-O-[2-(2-methylpropanoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 138566980 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-O-[(1,3-dioxoisoindol-2-yl)methyl] 1-O-[2-(2-methylpropanoyloxy)ethyl] butanedioate |
| SMILES | CC(C)C(=O)OCCOC(=O)CCC(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H21NO8/c1-12(2)19(25)27-10-9-26-15(21)7-8-16(22)28-11-20-17(23)13-5-3-4-6-14(13)18(20)24/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | HYYGUGAMIODIMU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|