C14H14BrNO4 — CID 54296614
(1,3-dioxoisoindol-2-yl)methyl 2-bromo-3-methylbutanoate (PubChem CID 54296614) has the molecular formula C14H14BrNO4 and a molecular weight of 340.17 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-bromo-3-methylbutanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-bromo-3-methylbutanoate |
|---|---|
| PubChem CID | 54296614 |
| Molecular Formula | C14H14BrNO4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-bromo-3-methylbutanoate |
| SMILES | CC(C)C(Br)C(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14BrNO4/c1-8(2)11(15)14(19)20-7-16-12(17)9-5-3-4-6-10(9)13(16)18/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | SBFGXMWPHAWCDJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|