C16H9Cl2NO4 — CID 4215357
(1,3-dioxoisoindol-2-yl)methyl 3,5-dichlorobenzoate (PubChem CID 4215357) has the molecular formula C16H9Cl2NO4 and a molecular weight of 350.16 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3,5-dichlorobenzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 4215357 |
| Molecular Formula | C16H9Cl2NO4 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3,5-dichlorobenzoate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H9Cl2NO4/c17-10-5-9(6-11(18)7-10)16(22)23-8-19-14(20)12-3-1-2-4-13(12)15(19)21/h1-7H,8H2 |
| InChIKey | XKCIZKJDXYHNSH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|