C17H11F2NO4 — CID 4545184
2-(1,3-dioxoisoindol-2-yl)ethyl 3,5-difluorobenzoate (PubChem CID 4545184) has the molecular formula C17H11F2NO4 and a molecular weight of 331.27 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 3,5-difluorobenzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 4545184 |
| Molecular Formula | C17H11F2NO4 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3,5-difluorobenzoate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H11F2NO4/c18-11-7-10(8-12(19)9-11)17(23)24-6-5-20-15(21)13-3-1-2-4-14(13)16(20)22/h1-4,7-9H,5-6H2 |
| InChIKey | QDGWWRWWVWWIBC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|