C17H12N2O6 — CID 7759660
(1,3-dioxoisoindol-2-yl)methyl 3-methyl-4-nitrobenzoate (PubChem CID 7759660) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-methyl-4-nitrobenzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 7759660 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCN2C(=O)c3ccccc3C2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N2O6/c1-10-8-11(6-7-14(10)19(23)24)17(22)25-9-18-15(20)12-4-2-3-5-13(12)16(18)21/h2-8H,9H2,1H3 |
| InChIKey | NKHHMDQPKQZHBF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|