C17H12N2O8S — CID 2475853
(1,3-dioxoisoindol-2-yl)methyl 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2475853) has the molecular formula C17H12N2O8S and a molecular weight of 404.36 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2475853 |
| Molecular Formula | C17H12N2O8S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCN2C(=O)c3ccccc3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N2O8S/c1-28(25,26)14-7-6-10(8-13(14)19(23)24)17(22)27-9-18-15(20)11-4-2-3-5-12(11)16(18)21/h2-8H,9H2,1H3 |
| InChIKey | LWTJIOGVECDZQY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|