About tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine
tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine (PubChem CID 70125960) has the molecular formula C20H26N2O6S
and a molecular weight of 422.50 g/mol. Its IUPAC name is tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine.
Molecular Properties
| Compound Name | tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine |
| PubChem CID | 70125960 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine |
| SMILES | CC(C)(C)OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1.NCCc1ccccc1 |
| InChI | InChI=1S/C12H15NO6S.C8H11N/c1-12(2,3)19-11(14)8-5-6-10(20(4,17)18)9(7-8)13(15)16;9-7-6-8-4-2-1-3-5-8/h5-7H,1-4H3;1-5H,6-7,9H2 |
| InChIKey | VGCQIAXIHABPRK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine?
The IUPAC name of tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine (CID 70125960) is tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine.
What is the SMILES notation for tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine?
The canonical SMILES for tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine is CC(C)(C)OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1.NCCc1ccccc1.
What is the InChIKey of tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine?
The InChIKey is VGCQIAXIHABPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO6S.C8H11N/c1-12(2,3)19-11(14)8-5-6-10(20(4,17)18)9(7-8)13(15)16;9-7-6-8-4-2-1-3-5-8/h5-7H,1-4H3;1-5H,6-7,9H2.
What are the key properties of tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine?
tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine has a molecular weight of 422.50 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-methylsulfonyl-3-nitrobenzoate;2-phenylethanamine is sourced from PubChem (CID 70125960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).