C15H11Cl2NO6S — CID 2078973
(2,4-dichlorophenyl)methyl 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2078973) has the molecular formula C15H11Cl2NO6S and a molecular weight of 404.23 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | (2,4-dichlorophenyl)methyl 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2078973 |
| Molecular Formula | C15H11Cl2NO6S |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCc2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11Cl2NO6S/c1-25(22,23)14-5-3-9(6-13(14)18(20)21)15(19)24-8-10-2-4-11(16)7-12(10)17/h2-7H,8H2,1H3 |
| InChIKey | SBMIYQJVHSTILC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|