C19H11NO6 — CID 7765330
(1,3-dioxoisoindol-2-yl)methyl 4-oxochromene-2-carboxylate (PubChem CID 7765330) has the molecular formula C19H11NO6 and a molecular weight of 349.30 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-oxochromene-2-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 7765330 |
| Molecular Formula | C19H11NO6 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-oxochromene-2-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H11NO6/c21-14-9-16(26-15-8-4-3-7-13(14)15)19(24)25-10-20-17(22)11-5-1-2-6-12(11)18(20)23/h1-9H,10H2 |
| InChIKey | WJGACKOZVJJGLP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|